| Name | gamma-hexalactone |
| Synonyms | 4-Hexanolide hexan-4-olide r-Hexyl Lactone gamma-hexalactone gamma-Caprolactone gamma-Hexanolactone (5S)-5-ethyldihydrofuran-2(3H)-one (5R)-5-ethyldihydrofuran-2(3H)-one gamma-Hexalactone~gamma-Hexanolactone |
| CAS | 695-06-7 |
| EINECS | 211-778-8 |
| InChI | InChI=1/C6H10O2/c1-2-5-3-4-6(7)8-5/h5H,2-4H2,1H3/t5-/m1/s1 |
| Molecular Formula | C6H10O2 |
| Molar Mass | 114.142 |
| Density | 1.002g/cm3 |
| Melting Point | -18°C |
| Boling Point | 214.9°C at 760 mmHg |
| Flash Point | 79.3°C |
| Vapor Presure | 0.152mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.431 |
| Physical and Chemical Properties | Chemical colorless liquid. Boiling point 220 ℃, soluble in ethanol and oil. It has a mild and powerful coumarin-like aroma with medicinal grass flavor, and has a coumarin and caramel-like taste. |
| Use | Use is commonly used as a modifying agent for coumarins in essences, such as in lavender, vanilla, and in fragrance types using oak moss as a sweet coating. Food flavor is widely used in cream, honey, vanilla beans, caramel and fruit-flavor compound and tobacco essence. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 2 |
| RTECS | LU4220000 |
| TSCA | Yes |
| HS Code | 29322090 |
| Toxicity | GRAS(FEMA)。 |
| Downstream Products | Hexanoic acid 4-OXO-HEXANOIC ACID 5-HYDROXYMETHYL-FURAN-2-CARBOXYLIC ACID |
| FEMA | 2556 | GAMMA-HEXALACTONE |
| Specific gravity | 1.023 |
| JECFA Number | 223 |
| BRN | 107260 |
| NIST chemical information | 2(3H)-Furanone, 5-ethyldihydro-(695-06-7) |
| EPA chemical information | 2(3H)-Furanone, 5-ethyldihydro- (695-06-7) |
| Hazard Note | Irritant |
content analysis
analyzed by gas chromatography in GT-10-4 and determined by polar column.
use limited
FEMA(mg/kg): soft drink 7.0; Cold drinks 0.07~84; Candy 21; Baked food 21.
Moderate limit (FDA & sect;172.515,2000).
use
GB 2760-96 specifies edible spices that are allowed to be used. Mainly used to prepare coconut, cream, honey, vanilla beans, fruits and tobacco flavors.
production method
It is obtained by the reaction of ethylene oxide and sodium malonate.